* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-40088956 |
| English Synonyms: | UKRORGSYN-BB BBV-40088956 |
| MDL Number.: | MFCD00175694 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)C(=O)N(C2=O)CSC(=N)N |
| InChi: | InChI=1S/C10H9N3O2S/c11-10(12)16-5-13-8(14)6-3-1-2-4-7(6)9(13)15/h1-4H,5H2,(H3,11,12) |
| InChiKey: | InChIKey=UCWCIDRVFIOYEM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.