* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-39844214 |
| English Synonyms: | UKRORGSYN-BB BBV-39844214 |
| MDL Number.: | MFCD00297115 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | C1CCC(CC1)SC(=N)N |
| InChi: | InChI=1S/C7H14N2S/c8-7(9)10-6-4-2-1-3-5-6/h6H,1-5H2,(H3,8,9) |
| InChiKey: | InChIKey=MCVXJUWPGZMOBO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.