* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-39132961 |
| English Synonyms: | UKRORGSYN-BB BBV-39132961 |
| MDL Number.: | MFCD00462334 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc(oc1)C(=O)N2CCCCCC2 |
| InChi: | InChI=1S/C11H15NO2/c13-11(10-6-5-9-14-10)12-7-3-1-2-4-8-12/h5-6,9H,1-4,7-8H2 |
| InChiKey: | InChIKey=KQDLQXUKRQCGOE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.