* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-39134839 |
| English Synonyms: | UKRORGSYN-BB BBV-39134839 |
| MDL Number.: | MFCD00465274 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CS(=O)(=O)N1CCN(CC1)S(=O)(=O)C |
| InChi: | InChI=1S/C6H14N2O4S2/c1-13(9,10)7-3-5-8(6-4-7)14(2,11)12/h3-6H2,1-2H3 |
| InChiKey: | InChIKey=OHBNNWFTVZANPH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.