* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-39186213 |
| English Synonyms: | UKRORGSYN-BB BBV-39186213 |
| MDL Number.: | MFCD00466763 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1ccc(c(c1)OC/C=C/Cl)Cl |
| InChi: | InChI=1S/C9H8Cl2O/c10-6-3-7-12-9-5-2-1-4-8(9)11/h1-6H,7H2/b6-3+ |
| InChiKey: | InChIKey=PEUBZPUQEZARPV-ZZXKWVIFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.