* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-39133119 |
| English Synonyms: | UKRORGSYN-BB BBV-39133119 |
| MDL Number.: | MFCD00594058 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc(oc1)C(=O)N2CCCC2 |
| InChi: | InChI=1S/C9H11NO2/c11-9(8-4-3-7-12-8)10-5-1-2-6-10/h3-4,7H,1-2,5-6H2 |
| InChiKey: | InChIKey=YBHIXZDADAIOMV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.