* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-40089406 |
| English Synonyms: | UKRORGSYN-BB BBV-40089406 |
| MDL Number.: | MFCD01007360 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | c1cc(ccc1F)S(=O)(=O)NNC(=S)N |
| InChi: | InChI=1S/C7H8FN3O2S2/c8-5-1-3-6(4-2-5)15(12,13)11-10-7(9)14/h1-4,11H,(H3,9,10,14) |
| InChiKey: | InChIKey=AFKPVVBKOGVGSK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.