* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-39841425 |
| English Synonyms: | UKRORGSYN-BB BBV-39841425 |
| MDL Number.: | MFCD01057663 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)CCSC(=N)N |
| InChi: | InChI=1S/C9H12N2S/c10-9(11)12-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H3,10,11) |
| InChiKey: | InChIKey=BQDZMSRPNHLCMX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.