* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-41937922 |
| English Synonyms: | UKRORGSYN-BB BBV-41937922 |
| MDL Number.: | MFCD01118734 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | COC(=O)Cn1c(nnn1)N |
| InChi: | InChI=1S/C4H7N5O2/c1-11-3(10)2-9-4(5)6-7-8-9/h2H2,1H3,(H2,5,6,8) |
| InChiKey: | InChIKey=GEBUOATUIQLOIN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.