* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-39859305 |
English Synonyms: | UKRORGSYN-BB BBV-39859305 |
MDL Number.: | MFCD08532140 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C=CCCSC(=N)N |
InChi: | InChI=1S/C5H10N2S/c1-2-3-4-8-5(6)7/h2H,1,3-4H2,(H3,6,7) |
InChiKey: | InChIKey=OIOUNGRUVXPLHQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.