* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-39846223 |
English Synonyms: | UKRORGSYN-BB BBV-39846223 |
MDL Number.: | MFCD08671490 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C1[C@H]2C[C@H]3C[C@@H]1C[C@@H](C2)C3NC=O |
InChi: | InChI=1S/C11H17NO/c13-6-12-11-9-2-7-1-8(4-9)5-10(11)3-7/h6-11H,1-5H2,(H,12,13)/t7-,8+,9-,10+,11? |
InChiKey: | InChIKey=SXYGFWZEAKCCIZ-XICIVTQQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.