* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-39132727 |
English Synonyms: | UKRORGSYN-BB BBV-39132727 |
MDL Number.: | MFCD09324192 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(sc1/C=C/C(=O)NC2CC2)Br |
InChi: | InChI=1S/C10H10BrNOS/c11-9-5-3-8(14-9)4-6-10(13)12-7-1-2-7/h3-7H,1-2H2,(H,12,13)/b6-4+ |
InChiKey: | InChIKey=NKKLYTJNDIILDP-GQCTYLIASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.