* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-41199523 |
English Synonyms: | UKRORGSYN-BB BBV-41199523 |
MDL Number.: | MFCD09733910 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC(C(=O)O)n1c(=O)ccc(=O)[nH]1 |
InChi: | InChI=1S/C7H8N2O4/c1-4(7(12)13)9-6(11)3-2-5(10)8-9/h2-4H,1H3,(H,8,10)(H,12,13) |
InChiKey: | InChIKey=GDOJKIBTMGQGDX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.