* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-40306311 |
English Synonyms: | UKRORGSYN-BB BBV-40306311 |
MDL Number.: | MFCD11611484 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cc1ccc(cc1C)S(=O)(=O)N[C@@H](C)CO |
InChi: | InChI=1S/C11H17NO3S/c1-8-4-5-11(6-9(8)2)16(14,15)12-10(3)7-13/h4-6,10,12-13H,7H2,1-3H3/t10-/m0/s1 |
InChiKey: | InChIKey=WHSSEFKBPPVUCP-JTQLQIEISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.