* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-27228395 |
English Synonyms: | UKRORGSYN-BB BBV-27228395 |
MDL Number.: | MFCD13789051 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(C)NC1(CC2CCC(C1)N2C)C(=O)O |
InChi: | InChI=1S/C12H22N2O2/c1-8(2)13-12(11(15)16)6-9-4-5-10(7-12)14(9)3/h8-10,13H,4-7H2,1-3H3,(H,15,16) |
InChiKey: | InChIKey=AMHUNVRUKHGEGQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.