* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-27228752 |
English Synonyms: | UKRORGSYN-BB BBV-27228752 |
MDL Number.: | MFCD13789093 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(C1CC2CC1C=C2)NC3CC3 |
InChi: | InChI=1S/C12H19N/c1-8(13-11-4-5-11)12-7-9-2-3-10(12)6-9/h2-3,8-13H,4-7H2,1H3 |
InChiKey: | InChIKey=HJMNLBZRQMIKQD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.