* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-36751664 |
English Synonyms: | UKRORGSYN-BB BBV-36751664 |
MDL Number.: | MFCD13789094 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(C1CC2CC1C=C2)NCC(=O)N |
InChi: | InChI=1S/C11H18N2O/c1-7(13-6-11(12)14)10-5-8-2-3-9(10)4-8/h2-3,7-10,13H,4-6H2,1H3,(H2,12,14) |
InChiKey: | InChIKey=LFKFCKRIFXYLFS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.