* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-27228896 |
English Synonyms: | UKRORGSYN-BB BBV-27228896 |
MDL Number.: | MFCD13789095 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(C1CC2CC1C=C2)N |
InChi: | InChI=1S/C9H15N/c1-6(10)9-5-7-2-3-8(9)4-7/h2-3,6-9H,4-5,10H2,1H3 |
InChiKey: | InChIKey=KBPVMSDSFGSXLE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.