* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-27228953 |
English Synonyms: | UKRORGSYN-BB BBV-27228953 |
MDL Number.: | MFCD13789096 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(C1CC2CC1C=C2)NCCN(C)C |
InChi: | InChI=1S/C13H24N2/c1-10(14-6-7-15(2)3)13-9-11-4-5-12(13)8-11/h4-5,10-14H,6-9H2,1-3H3 |
InChiKey: | InChIKey=ZISMTMVGIYJYJX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.