* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-27229474 |
English Synonyms: | UKRORGSYN-BB BBV-27229474 |
MDL Number.: | MFCD13789145 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(C1CC2CC1C=C2)NCC#C |
InChi: | InChI=1S/C12H17N/c1-3-6-13-9(2)12-8-10-4-5-11(12)7-10/h1,4-5,9-13H,6-8H2,2H3 |
InChiKey: | InChIKey=HUISUJMNODOIGH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.