* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-37738017 |
English Synonyms: | UKRORGSYN-BB BBV-37738017 |
MDL Number.: | MFCD13811723 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CN(C)/C=C\1/CCCCC1=O |
InChi: | InChI=1S/C9H15NO/c1-10(2)7-8-5-3-4-6-9(8)11/h7H,3-6H2,1-2H3/b8-7- |
InChiKey: | InChIKey=UQRGFCOZZZCUDG-FPLPWBNLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.