* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-32581129 |
English Synonyms: | UKRORGSYN-BB BBV-32581129 |
MDL Number.: | MFCD14602311 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC/C=C(/C)\C(=O)NC1CC2CCC(C1)N2 |
InChi: | InChI=1S/C13H22N2O/c1-3-4-9(2)13(16)15-12-7-10-5-6-11(8-12)14-10/h4,10-12,14H,3,5-8H2,1-2H3,(H,15,16)/b9-4- |
InChiKey: | InChIKey=WAQUNLDKDPOJFG-WTKPLQERSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.