* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-32581133 |
English Synonyms: | UKRORGSYN-BB BBV-32581133 |
MDL Number.: | MFCD14602312 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C/C=C/C(=O)NC1CC2CCC(C1)N2 |
InChi: | InChI=1S/C11H18N2O/c1-2-3-11(14)13-10-6-8-4-5-9(7-10)12-8/h2-3,8-10,12H,4-7H2,1H3,(H,13,14)/b3-2+ |
InChiKey: | InChIKey=XJHDTYXEMLZFNB-NSCUHMNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.