* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-32581952 |
English Synonyms: | UKRORGSYN-BB BBV-32581952 |
MDL Number.: | MFCD14602380 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C/C=C/C(=O)N(C)C1CC2CCC(C1)N2 |
InChi: | InChI=1S/C12H20N2O/c1-3-4-12(15)14(2)11-7-9-5-6-10(8-11)13-9/h3-4,9-11,13H,5-8H2,1-2H3/b4-3+ |
InChiKey: | InChIKey=VYCXTTWDWFQUEN-ONEGZZNKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.