* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-32582303 |
English Synonyms: | UKRORGSYN-BB BBV-32582303 |
MDL Number.: | MFCD14602411 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CN(C/C=C/Cl)C1CC2CCC(C1)N2 |
InChi: | InChI=1S/C11H19ClN2/c1-14(6-2-5-12)11-7-9-3-4-10(8-11)13-9/h2,5,9-11,13H,3-4,6-8H2,1H3/b5-2+ |
InChiKey: | InChIKey=FEVONVMNHAEGHU-GORDUTHDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.