* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-32582307 |
English Synonyms: | UKRORGSYN-BB BBV-32582307 |
MDL Number.: | MFCD14602414 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C=C/CN(C)C1CC2CCC(C1)N2 |
InChi: | InChI=1S/C12H22N2/c1-3-4-7-14(2)12-8-10-5-6-11(9-12)13-10/h3-4,10-13H,5-9H2,1-2H3/b4-3+ |
InChiKey: | InChIKey=RSEJHLVYSZBETG-ONEGZZNKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.