* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-32583136 |
English Synonyms: | UKRORGSYN-BB BBV-32583136 |
MDL Number.: | MFCD14602481 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCN(C1CC2CCC(C1)N2)C(=O)/C=C/C |
InChi: | InChI=1S/C13H22N2O/c1-3-5-13(16)15(4-2)12-8-10-6-7-11(9-12)14-10/h3,5,10-12,14H,4,6-9H2,1-2H3/b5-3+ |
InChiKey: | InChIKey=JSDILFMFSZDOLN-HWKANZROSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.