* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-32583563 |
English Synonyms: | UKRORGSYN-BB BBV-32583563 |
MDL Number.: | MFCD14602510 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCN(C/C=C/Cl)C1CC2CCC(C1)N2 |
InChi: | InChI=1S/C12H21ClN2/c1-2-15(7-3-6-13)12-8-10-4-5-11(9-12)14-10/h3,6,10-12,14H,2,4-5,7-9H2,1H3/b6-3+ |
InChiKey: | InChIKey=WIDYBFVGUIXLCN-ZZXKWVIFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.