* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-38738584 |
English Synonyms: | UKRORGSYN-BB BBV-38738584 |
MDL Number.: | MFCD14602553 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1c(csc1CN2C3CCC2CC(C3)N)Br |
InChi: | InChI=1S/C12H17BrN2S/c13-8-3-12(16-7-8)6-15-10-1-2-11(15)5-9(14)4-10/h3,7,9-11H,1-2,4-6,14H2 |
InChiKey: | InChIKey=MSFOFPMBTJIHCB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.