* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-32585020 |
English Synonyms: | UKRORGSYN-BB BBV-32585020 |
MDL Number.: | MFCD14602660 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C1CC2CC(CC1N2C/C=C/Cl)N |
InChi: | InChI=1S/C10H17ClN2/c11-4-1-5-13-9-2-3-10(13)7-8(12)6-9/h1,4,8-10H,2-3,5-7,12H2/b4-1+ |
InChiKey: | InChIKey=VBXBCKGHOQHSCR-DAFODLJHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.