* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-32585024 |
English Synonyms: | UKRORGSYN-BB BBV-32585024 |
MDL Number.: | MFCD14602663 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C=C/CN1C2CCC1CC(C2)N |
InChi: | InChI=1S/C11H20N2/c1-2-3-6-13-10-4-5-11(13)8-9(12)7-10/h2-3,9-11H,4-8,12H2,1H3/b3-2+ |
InChiKey: | InChIKey=WNMRLJQEKPJPHY-NSCUHMNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.