* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-32792774 |
English Synonyms: | UKRORGSYN-BB BBV-32792774 |
MDL Number.: | MFCD14643283 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC(/C(=N/O)/N)NC(=O)C1CC2CCC1C2 |
InChi: | InChI=1S/C11H19N3O2/c1-6(10(12)14-16)13-11(15)9-5-7-2-3-8(9)4-7/h6-9,16H,2-5H2,1H3,(H2,12,14)(H,13,15) |
InChiKey: | InChIKey=YZLQOCNMVYOLBY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.