* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-32792816 |
English Synonyms: | UKRORGSYN-BB BBV-32792816 |
MDL Number.: | MFCD14643297 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C1CC2CC1CC2/C(=N\N)/N |
InChi: | InChI=1S/C8H15N3/c9-8(11-10)7-4-5-1-2-6(7)3-5/h5-7H,1-4,10H2,(H2,9,11) |
InChiKey: | InChIKey=BPHPTPDOBYNNRT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.