* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-32959594 |
| English Synonyms: | UKRORGSYN-BB BBV-32959594 |
| MDL Number.: | MFCD14693914 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(CN1CC2CCC1C2)/C(=N/O)/N |
| InChi: | InChI=1S/C10H19N3O/c1-7(10(11)12-14)5-13-6-8-2-3-9(13)4-8/h7-9,14H,2-6H2,1H3,(H2,11,12) |
| InChiKey: | InChIKey=XBRSWTQUFQFZMP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.