* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-41197409 |
English Synonyms: | UKRORGSYN-BB BBV-41197409 |
MDL Number.: | MFCD14733137 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1cc(no1)C(=O)NCC=C |
InChi: | InChI=1S/C8H10N2O2/c1-3-4-9-8(11)7-5-6(2)12-10-7/h3,5H,1,4H2,2H3,(H,9,11) |
InChiKey: | InChIKey=HZVMMUQWCDMUTK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.