* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-39136275 |
English Synonyms: | UKRORGSYN-BB BBV-39136275 |
MDL Number.: | MFCD14869029 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C1CC1C(=O)NCC(=O)NC2CC2 |
InChi: | InChI=1S/C9H14N2O2/c12-8(11-7-3-4-7)5-10-9(13)6-1-2-6/h6-7H,1-5H2,(H,10,13)(H,11,12) |
InChiKey: | InChIKey=YOVKQXWQDYDSMW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.