* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-39139077 |
English Synonyms: | UKRORGSYN-BB BBV-39139077 |
MDL Number.: | MFCD14876827 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC1COCCN1C(=O)C2CC2 |
InChi: | InChI=1S/C9H15NO2/c1-7-6-12-5-4-10(7)9(11)8-2-3-8/h7-8H,2-6H2,1H3 |
InChiKey: | InChIKey=JIGKJLBUMGRYSE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.