* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-39135154 |
English Synonyms: | UKRORGSYN-BB BBV-39135154 |
MDL Number.: | MFCD14880725 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C=CCNC(=O)CCc1cccs1 |
InChi: | InChI=1S/C10H13NOS/c1-2-7-11-10(12)6-5-9-4-3-8-13-9/h2-4,8H,1,5-7H2,(H,11,12) |
InChiKey: | InChIKey=ZHDZTBLMLVFUBB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.