* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-39133803 |
English Synonyms: | UKRORGSYN-BB BBV-39133803 |
MDL Number.: | MFCD15109469 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(=O)NCCNC(=O)c1cccs1 |
InChi: | InChI=1S/C9H12N2O2S/c1-7(12)10-4-5-11-9(13)8-3-2-6-14-8/h2-3,6H,4-5H2,1H3,(H,10,12)(H,11,13) |
InChiKey: | InChIKey=LUBZAKWUXXDPCC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.