* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-41946182 |
English Synonyms: | UKRORGSYN-BB BBV-41946182 |
MDL Number.: | MFCD15205358 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CCCN(CCCl)C(C)CC |
InChi: | InChI=1S/C9H20ClN/c1-4-7-11(8-6-10)9(3)5-2/h9H,4-8H2,1-3H3 |
InChiKey: | InChIKey=RGDWJPQNRXZISK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.