* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-36628269 |
English Synonyms: | UKRORGSYN-BB BBV-36628269 |
MDL Number.: | MFCD15422280 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | Cc1csc(=O)n1CC(=O)Nc2[nH]cnn2 |
InChi: | InChI=1S/C8H9N5O2S/c1-5-3-16-8(15)13(5)2-6(14)11-7-9-4-10-12-7/h3-4H,2H2,1H3,(H2,9,10,11,12,14) |
InChiKey: | InChIKey=KSPFZVWAORGSIH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.