* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-39138344 |
English Synonyms: | UKRORGSYN-BB BBV-39138344 |
MDL Number.: | MFCD15820079 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CS(=O)(=O)NCC1CCS(=O)(=O)C1 |
InChi: | InChI=1S/C6H13NO4S2/c1-12(8,9)7-4-6-2-3-13(10,11)5-6/h6-7H,2-5H2,1H3 |
InChiKey: | InChIKey=FYGKYPGLEYFLQA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.