* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-39137722 |
English Synonyms: | UKRORGSYN-BB BBV-39137722 |
MDL Number.: | MFCD16570208 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1(CCS(=O)(=O)C1)NC(=O)COC |
InChi: | InChI=1S/C8H15NO4S/c1-8(9-7(10)5-13-2)3-4-14(11,12)6-8/h3-6H2,1-2H3,(H,9,10) |
InChiKey: | InChIKey=INPHJGKASHJNDO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.