* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34551379 |
English Synonyms: | UKRORGSYN-BB BBV-34551379 |
MDL Number.: | MFCD16664341 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCOC(=O)/C=C(/C)\Nc1ccc(cc1)Cl |
InChi: | InChI=1S/C12H14ClNO2/c1-3-16-12(15)8-9(2)14-11-6-4-10(13)5-7-11/h4-8,14H,3H2,1-2H3/b9-8- |
InChiKey: | InChIKey=XZLWEBJIBFUTCP-HJWRWDBZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.