* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34225777 |
English Synonyms: | UKRORGSYN-BB BBV-34225777 |
MDL Number.: | MFCD16751214 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC(C1CC1)n2c(cc(n2)COC)S |
InChi: | InChI=1S/C10H16N2OS/c1-7(8-3-4-8)12-10(14)5-9(11-12)6-13-2/h5,7-8,14H,3-4,6H2,1-2H3 |
InChiKey: | InChIKey=FBVCJNOBMSALDI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.