* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34319401 |
| English Synonyms: | UKRORGSYN-BB BBV-34319401 |
| MDL Number.: | MFCD16783069 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCC(Cc1cc(cs1)Br)CNC(C)C |
| InChi: | InChI=1S/C12H20BrNS/c1-4-10(7-14-9(2)3)5-12-6-11(13)8-15-12/h6,8-10,14H,4-5,7H2,1-3H3 |
| InChiKey: | InChIKey=CTRSQVSYZLMKOF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.