* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34319405 |
| English Synonyms: | UKRORGSYN-BB BBV-34319405 |
| MDL Number.: | MFCD16783073 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCC(Cc1cscn1)CNC(C)C |
| InChi: | InChI=1S/C11H20N2S/c1-4-10(6-12-9(2)3)5-11-7-14-8-13-11/h7-10,12H,4-6H2,1-3H3 |
| InChiKey: | InChIKey=BNGGTSRADKCXMV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.