* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34320784 |
English Synonyms: | UKRORGSYN-BB BBV-34320784 |
MDL Number.: | MFCD16784353 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCCC(CNCc1ccc(o1)C)N |
InChi: | InChI=1S/C12H22N2O/c1-3-4-5-11(13)8-14-9-12-7-6-10(2)15-12/h6-7,11,14H,3-5,8-9,13H2,1-2H3 |
InChiKey: | InChIKey=WYOZYIWKHRLUGH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.