* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34321379 |
| English Synonyms: | UKRORGSYN-BB BBV-34321379 |
| MDL Number.: | MFCD16784915 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCC1(COC2CCOCC2N1)CC |
| InChi: | InChI=1S/C11H21NO2/c1-3-11(4-2)8-14-10-5-6-13-7-9(10)12-11/h9-10,12H,3-8H2,1-2H3 |
| InChiKey: | InChIKey=MPIOQQFNAVFNPN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.