* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34344204 |
English Synonyms: | UKRORGSYN-BB BBV-34344204 |
MDL Number.: | MFCD16795457 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCCN(C)CCNCc1ccoc1 |
InChi: | InChI=1S/C12H22N2O/c1-3-4-7-14(2)8-6-13-10-12-5-9-15-11-12/h5,9,11,13H,3-4,6-8,10H2,1-2H3 |
InChiKey: | InChIKey=NMEHSMZTLRUIJX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.